EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9Br2NO3 |
| Net Charge | 0 |
| Average Mass | 338.983 |
| Monoisotopic Mass | 336.89492 |
| SMILES | N[C@@H](Cc1cc(Br)c(O)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C9H9Br2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1 |
| InChIKey | COESHZUDRKCEPA-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. |
| Application: | antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dibromo-L-tyrosine (CHEBI:28335) has role antithyroid drug (CHEBI:50671) |
| 3,5-dibromo-L-tyrosine (CHEBI:28335) has role human xenobiotic metabolite (CHEBI:76967) |
| 3,5-dibromo-L-tyrosine (CHEBI:28335) is a bromoamino acid (CHEBI:22930) |
| 3,5-dibromo-L-tyrosine (CHEBI:28335) is a dihalogenated L-tyrosine (CHEBI:53680) |
| 3,5-dibromo-L-tyrosine (CHEBI:28335) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 3,5-dibromo-L-tyrosine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoic acid | IUPAC |
| 3,5-Dibromo-L-tyrosine | KEGG COMPOUND |
| 3,5-dibromotyrosine | ChEBI |
| 3,5 DIBROMOTYROSINE | PDBeChem |
| DiBrY | ChEBI |
| Citations |
|---|