EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H44O12 |
| Net Charge | 0 |
| Average Mass | 620.692 |
| Monoisotopic Mass | 620.28328 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@](O)(CC[C@]3([H])c3ccc(=O)oc3)[C@]1(O)C[C@@H](OC(C)=O)C1=C[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@@]12C |
| InChI | InChI=1S/C32H44O12/c1-16(34)42-21-13-31(39)23(8-10-30(3)19(7-11-32(30,31)40)17-4-5-24(35)41-15-17)29(2)9-6-18(12-20(21)29)43-28-27(38)26(37)25(36)22(14-33)44-28/h4-5,12,15,18-19,21-23,25-28,33,36-40H,6-11,13-14H2,1-3H3/t18-,19+,21+,22+,23+,25+,26-,27+,28+,29-,30+,31-,32+/m0/s1 |
| InChIKey | LSMIOFMZNVEEBR-ICLSSMQGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Drimia maritima (ncbitaxon:82070) | bulb (BTO:0000159) | PubMed (17236017) | |
| Urginea pancration (IPNI:543298-1) | bulb (BTO:0000159) | PubMed (17221395) |
| Roles Classification |
|---|
| Biological Role: | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Na+/K+-transporting ATPase (EC 3.6.3.9). |
| Application: | rodenticide A substance used to destroy rodent pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scilliroside (CHEBI:28332) has functional parent scillirosidin (CHEBI:37417) |
| scilliroside (CHEBI:28332) has role EC 3.6.3.9 (Na+/K+-transporting ATPase) inhibitor (CHEBI:63510) |
| scilliroside (CHEBI:28332) has role rodenticide (CHEBI:33288) |
| scilliroside (CHEBI:28332) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 6β-(acetyloxy)-3β-(β-D-glucopyranosyloxy)-8,14-dihydroxybufa-4,20,22-trienolide |
| Synonyms | Source |
|---|---|
| 3-O-(β-D-glucopyranosyl)-6β-acetoxy-3β,8β,14β-trihydroxybufa-4,20,22-trienolide | LIPID MAPS |
| (3β,6β)-6-(acetyloxy)-3-(β-D-glucopyranosyloxy)-8,14-dihydroxybufa-4,20,22-trienolide | Alan Wood's Pesticides |
| 3β-(β-D-glucopyranosyloxy)-17β-(2-oxo-2H-pyran-5-yl)-14β-androst-4-ene-6β,8,14-triol 6-acetate | Alan Wood's Pesticides |
| scilliroside | KEGG COMPOUND |
| scillirosidin 3-O-glucoside | LIPID MAPS |
| scillirosidin 3-O-β-D-glucoside | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Dethdiet | ChEBI |
| Rat-o-Cide | ChEBI |
| Red squill | ChemIDplus |
| Rodene | ChEBI |
| Rodine | ChEBI |
| Silmine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 390447 | ChemSpider |
| 588 | BPDB |
| C00003637 | KNApSAcK |
| C08880 | KEGG COMPOUND |
| CH634200 | Patent |
| LMST01130007 | LIPID MAPS |
| scilliroside | Alan Wood's Pesticides |
| Scilliroside | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:74900 | Reaxys |
| CAS:507-60-8 | ChemIDplus |
| CAS:507-60-8 | KEGG COMPOUND |
| Citations |
|---|