EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28330 - 4-hydroxy-L-threonine
| Formula | C4H9NO4 |
| Net Charge | 0 |
| Average Mass | 135.119 |
| Monoisotopic Mass | 135.05316 |
| SMILES | N[C@H](C(=O)O)[C@H](O)CO |
| InChI | InChI=1S/C4H9NO4/c5-3(4(8)9)2(7)1-6/h2-3,6-7H,1,5H2,(H,8,9)/t2-,3+/m1/s1 |
| InChIKey | JBNUARFQOCGDRK-GBXIJSLDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-L-threonine (CHEBI:28330) has role Escherichia coli metabolite (CHEBI:76971) |
| 4-hydroxy-L-threonine (CHEBI:28330) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 4-hydroxy-L-threonine (CHEBI:28330) is a L-threonine derivative (CHEBI:84189) |
| 4-hydroxy-L-threonine (CHEBI:28330) is a hydroxy-amino acid (CHEBI:24662) |
| 4-hydroxy-L-threonine (CHEBI:28330) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 4-hydroxy-L-threonine (CHEBI:28330) is tautomer of 4-hydroxy-L-threonine zwitterion (CHEBI:60904) |
| Incoming Relation(s) |
| 4-hydroxy-L-threonine zwitterion (CHEBI:60904) is tautomer of 4-hydroxy-L-threonine (CHEBI:28330) |
| IUPAC Names |
|---|
| 4-hydroxy-L-threonine |
| (2S,3S)-2-amino-3,4-dihydroxybutanoic acid |
| Synonyms | Source |
|---|---|
| 4-Hydroxy-L-threonine | KEGG COMPOUND |
| hydroxythreonine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1722829 | Beilstein |
| Reaxys:1722829 | Reaxys |
| CAS:21768-45-6 | ChemIDplus |