EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O3 |
| Net Charge | 0 |
| Average Mass | 228.247 |
| Monoisotopic Mass | 228.07864 |
| SMILES | Cc1cc2cc3c(C)cc(=O)oc3c(C)c2o1 |
| InChI | InChI=1S/C14H12O3/c1-7-4-12(15)17-14-9(3)13-10(6-11(7)14)5-8(2)16-13/h4-6H,1-3H3 |
| InChIKey | FMHHVULEAZTJMA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trioxsalen (CHEBI:28329) has role dermatologic drug (CHEBI:50177) |
| trioxsalen (CHEBI:28329) has role photosensitizing agent (CHEBI:47868) |
| trioxsalen (CHEBI:28329) is a psoralens (CHEBI:26369) |
| IUPAC Name |
|---|
| 2,5,9-trimethyl-7H-furo[3,2-g]chromen-7-one |
| INNs | Source |
|---|---|
| trioxisaleno | ChemIDplus |
| trioxysalen | ChEBI |
| trioxysalene | ChemIDplus |
| trioxysalenum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2',4,8-Trimethylpsoralen | NIST Chemistry WebBook |
| 4,5',8-Trimethylpsoralen | ChemIDplus |
| 4,8,5'-Trimethylpsoralen | KEGG COMPOUND |
| 4,8,5'-Trimethylpsoralen | KEGG COMPOUND |
| 6-hydroxy-β,2,7-trimethyl-5-benzofuranacrylic acid, δ-lactone | NIST Chemistry WebBook |
| Trimethylpsoralen | ChemIDplus |