EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O4 |
| Net Charge | 0 |
| Average Mass | 346.467 |
| Monoisotopic Mass | 346.21441 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(=O)CO |
| InChI | InChI=1S/C21H30O4/c1-19-8-5-14(23)11-13(19)3-4-15-16(19)6-9-20(2)17(15)7-10-21(20,25)18(24)12-22/h11,15-17,22,25H,3-10,12H2,1-2H3/t15-,16+,17+,19+,20+,21+/m1/s1 |
| InChIKey | WHBHBVVOGNECLV-OBQKJFGGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-deoxycortisol (CHEBI:28324) has role human metabolite (CHEBI:77746) |
| 11-deoxycortisol (CHEBI:28324) has role mouse metabolite (CHEBI:75771) |
| 11-deoxycortisol (CHEBI:28324) is a deoxycortisol (CHEBI:23618) |
| 11-deoxycortisol (CHEBI:28324) is a glucocorticoid (CHEBI:24261) |
| 11-deoxycortisol (CHEBI:28324) is a primary α-hydroxy ketone (CHEBI:139590) |
| 11-deoxycortisol (CHEBI:28324) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 17,21-dihydroxypregn-4-ene-3,20-dione |
| INN | Source |
|---|---|
| cortodoxona | WHO MedNet |
| Synonyms | Source |
|---|---|
| 11-Deoxycortisol | KEGG COMPOUND |
| 11-deoxycortisone | ChEMBL |
| 11-desoxy-17-hydroxycorticosterone | ChemIDplus |
| 17.alpha.-hydroxycortexone | ChEMBL |
| Cortexolone | ChEMBL |
| Cortifen | ChEMBL |
| UniProt Name | Source |
|---|---|
| 11-deoxycortisol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05488 | KEGG COMPOUND |
| Cortexolone | Wikipedia |
| D03595 | KEGG DRUG |
| HMDB0000015 | HMDB |
| LMST02030086 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2511358 | Reaxys |
| CAS:152-58-9 | ChemIDplus |
| CAS:152-58-9 | KEGG COMPOUND |
| Citations |
|---|