EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4N4O2 |
| Net Charge | 0 |
| Average Mass | 152.113 |
| Monoisotopic Mass | 152.03343 |
| SMILES | O=c1nc(=O)c2cnnc2n1 |
| InChI | InChI=1S/C5H4N4O2/c10-4-2-1-6-9-3(2)7-5(11)8-4/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | HXNFUBHNUDHIGC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 1.17.3.2 (xanthine oxidase) inhibitor An EC 1.17.3.* (oxidoreductase acting on CH or CH2 with oxygen as acceptor) inhibitor that interferes with the action of xanthine oxidase (EC 1.17.3.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alloxanthine (CHEBI:28315) has role drug metabolite (CHEBI:49103) |
| alloxanthine (CHEBI:28315) has role EC 1.17.3.2 (xanthine oxidase) inhibitor (CHEBI:35634) |
| alloxanthine (CHEBI:28315) is a pyrazolopyrimidine (CHEBI:38669) |
| Incoming Relation(s) |
| 7-isobutyl-5-methyl-2-(1-naphthylmethyl)-3-(4-pyridyl)alloxanthine (CHEBI:39506) has functional parent alloxanthine (CHEBI:28315) |
| IUPAC Name |
|---|
| 1H-pyrazolo[3,4-d]pyrimidine-4,6(5H,7H)-dione |
| Synonyms | Source |
|---|---|
| Alloxanthine | KEGG COMPOUND |
| Oxipurinol | KEGG COMPOUND |
| Oxoallopurinol | ChemIDplus |
| Oxypurinol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2154 | BPDB |
| C07599 | KEGG COMPOUND |
| D02365 | KEGG DRUG |
| HMDB0000786 | HMDB |
| Oxypurinol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:139956 | Reaxys |
| CAS:2465-59-0 | KEGG COMPOUND |
| CAS:2465-59-0 | ChemIDplus |
| Citations |
|---|