EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28303 - 2-chlorobenzoate
| Formula | C7H4ClO2 |
| Net Charge | -1 |
| Average Mass | 155.560 |
| Monoisotopic Mass | 154.99053 |
| SMILES | O=C([O-])c1ccccc1Cl |
| InChI | InChI=1S/C7H5ClO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10)/p-1 |
| InChIKey | IKCLCGXPQILATA-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chlorobenzoate (CHEBI:28303) has role plant metabolite (CHEBI:76924) |
| 2-chlorobenzoate (CHEBI:28303) is a 2-halobenzoate (CHEBI:70856) |
| 2-chlorobenzoate (CHEBI:28303) is a chlorobenzoate (CHEBI:23133) |
| 2-chlorobenzoate (CHEBI:28303) is conjugate base of 2-chlorobenzoic acid (CHEBI:30793) |
| Incoming Relation(s) |
| 2-chlorobenzoyl-AMP(1−) (CHEBI:188501) has functional parent 2-chlorobenzoate (CHEBI:28303) |
| 2-chlorobenzoyl-CoA(4−) (CHEBI:188500) has functional parent 2-chlorobenzoate (CHEBI:28303) |
| 2-chlorobenzoic acid (CHEBI:30793) is conjugate acid of 2-chlorobenzoate (CHEBI:28303) |
| IUPAC Name |
|---|
| 2-chlorobenzoate |
| Synonyms | Source |
|---|---|
| o-chlorobenzoate | ChEBI |
| oCl-benzoate anion | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 2-chlorobenzoate | UniProt |