EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H41N5O7 |
| Net Charge | 0 |
| Average Mass | 463.576 |
| Monoisotopic Mass | 463.30060 |
| SMILES | [H][C@](C)(N)[C@]1([H])CC[C@@H](N)[C@@H](O[C@H]2[C@H](O)[C@H](O[C@H]3OC[C@](C)(O)[C@H](NC)[C@H]3O)[C@H](N)C[C@@H]2N)O1 |
| InChI | InChI=1S/C20H41N5O7/c1-8(21)12-5-4-9(22)18(30-12)31-15-10(23)6-11(24)16(13(15)26)32-19-14(27)17(25-3)20(2,28)7-29-19/h8-19,25-28H,4-7,21-24H2,1-3H3/t8-,9-,10+,11-,12+,13+,14-,15-,16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | XUFIWSHGXVLULG-JYDJLPLMSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gentamycin C2 (CHEBI:28292) is a gentamycin C (CHEBI:28417) |
| gentamycin C2 (CHEBI:28292) is conjugate base of gentamycin C2(+5) (CHEBI:231949) |
| Incoming Relation(s) |
| gentamycin C2(+5) (CHEBI:231949) is conjugate acid of gentamycin C2 (CHEBI:28292) |
| IUPAC Name |
|---|
| (1R,2S,3R,4R,6S)-4,6-diamino-3-[3-deoxy-4-C-methyl-3-(methylamino)-β-L-arabinopyranosyloxy]-2-hydroxycyclohexyl 2,6-diamino-2,3,4,6,7-pentadeoxy-α-D-ribo-heptopyranoside |
| Synonyms | Source |
|---|---|
| Gentamicin C2 | KEGG COMPOUND |
| Gentamycin C2 | ChemIDplus |
| O-3-Deoxy-4-C-methyl-3-(methylamino)-beta-L-arabinopyranosyl-(1-6)-O-(2,6-diamino-2,3,4,6,7-pentadeoxy-alpha-D-ribo-heptopyranosyl-(1-4))-2-deoxy-D-streptamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C02033 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:25876-11-3 | KEGG COMPOUND |
| CAS:25876-11-3 | ChemIDplus |