EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO4 |
| Net Charge | 0 |
| Average Mass | 265.309 |
| Monoisotopic Mass | 265.13141 |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H19NO4/c1-10(2)8-12(13(16)17)15-14(18)19-9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H,15,18)(H,16,17)/t12-/m0/s1 |
| InChIKey | USPFMEKVPDBMCG-LBPRGKRZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzyloxycarbonyl-L-leucine (CHEBI:28282) is a L-leucine derivative (CHEBI:25018) |
| N-benzyloxycarbonyl-L-leucine (CHEBI:28282) is a carbamate ester (CHEBI:23003) |
| N-benzyloxycarbonyl-L-leucine (CHEBI:28282) is conjugate acid of N-benzyloxycarbonyl-L-leucinate (CHEBI:58558) |
| Incoming Relation(s) |
| N-benzyloxycarbonyl-L-leucinate (CHEBI:58558) is conjugate base of N-benzyloxycarbonyl-L-leucine (CHEBI:28282) |
| IUPAC Name |
|---|
| N-benzyloxycarbonyl-L-leucine |
| Synonyms | Source |
|---|---|
| Carbobenzoxy-L-leucine | ChemIDplus |
| Carbobenzyloxy-L-leucine | ChemIDplus |
| N(alpha)-Benzyloxycarbonyl-L-leucine | KEGG COMPOUND |
| N-((Phenylmethoxy)carbonyl)-L-leucine | ChemIDplus |