EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H48O6 |
| Net Charge | 0 |
| Average Mass | 480.686 |
| Monoisotopic Mass | 480.34509 |
| SMILES | [H][C@@]12COC(=O)[C@@]3([H])C[C@H](O)[C@H](O)C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@@H](O)[C@H](O)[C@@H](C)C(C)C |
| InChI | InChI=1S/C28H48O6/c1-14(2)15(3)24(31)25(32)16(4)18-7-8-19-17-13-34-26(33)21-11-22(29)23(30)12-28(21,6)20(17)9-10-27(18,19)5/h14-25,29-32H,7-13H2,1-6H3/t15-,16-,17-,18+,19-,20-,21+,22-,23+,24+,25+,27+,28+/m0/s1 |
| InChIKey | IXVMHGVQKLDRKH-KNBKMWSGSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brassinolide (CHEBI:28277) has role plant growth stimulator (CHEBI:26157) |
| brassinolide (CHEBI:28277) has role plant hormone (CHEBI:37848) |
| brassinolide (CHEBI:28277) is a 22-hydroxy steroid (CHEBI:36863) |
| brassinolide (CHEBI:28277) is a 23-hydroxy steroid (CHEBI:36866) |
| brassinolide (CHEBI:28277) is a 2α-hydroxy steroid (CHEBI:36858) |
| brassinolide (CHEBI:28277) is a 3α-hydroxy steroid (CHEBI:36835) |
| brassinolide (CHEBI:28277) is a brassinosteroid (CHEBI:22921) |
| Incoming Relation(s) |
| 26-hydroxybrassinolide (CHEBI:133461) has functional parent brassinolide (CHEBI:28277) |
| brassinolide 23-O-α-D-glucoside (CHEBI:133468) has functional parent brassinolide (CHEBI:28277) |
| IUPAC Name |
|---|
| (22R,23R)-2α,3α,22,23-tetrahydroxy-7a-homo-7-oxa-5α-campestan-6-one |
| Synonyms | Source |
|---|---|
| (22R,23R)-2α,3α,22,23-tetrahydroxy-6,7-seco-5α-campestano-6,7-lactone | IUPAC |
| Brassinolide | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| brassinolide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1724 | BPDB |
| C00000176 | KNApSAcK |
| C08814 | KEGG COMPOUND |
| LMST01140001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3633298 | Beilstein |
| CAS:72962-43-7 | ChemIDplus |
| CAS:72962-43-7 | KEGG COMPOUND |