EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9N3O7 |
| Net Charge | 0 |
| Average Mass | 271.185 |
| Monoisotopic Mass | 271.04405 |
| SMILES | N[C@@H](Cc1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C9H9N3O7/c10-5(9(14)15)1-4-2-6(11(16)17)8(13)7(3-4)12(18)19/h2-3,5,13H,1,10H2,(H,14,15)/t5-/m0/s1 |
| InChIKey | SAZOSDSFLRXREA-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dinitro-L-tyrosine (CHEBI:28275) is a C-nitro compound (CHEBI:35716) |
| 3,5-dinitro-L-tyrosine (CHEBI:28275) is a L-tyrosine derivative (CHEBI:27177) |
| 3,5-dinitro-L-tyrosine (CHEBI:28275) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 3,5-dinitro-L-tyrosine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(4-hydroxy-3,5-dinitrophenyl)propanoic acid | IUPAC |
| 3,5-Dinitro-L-tyrosine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03225 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3221783 | Beilstein |
| CAS:17360-11-1 | KEGG COMPOUND |
| CAS:18386-16-8 | ChemIDplus |