EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O3 |
| Net Charge | 0 |
| Average Mass | 224.300 |
| Monoisotopic Mass | 224.14124 |
| SMILES | CC1=CC(=O)CC(C)(C)C1(O)/C=C/C(C)O |
| InChI | InChI=1S/C13H20O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h5-7,10,14,16H,8H2,1-4H3/b6-5+ |
| InChIKey | KPQMCAKZRXOZLB-AATRIKPKSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vomifoliol (CHEBI:28258) has role plant metabolite (CHEBI:76924) |
| vomifoliol (CHEBI:28258) is a fenchane monoterpenoid (CHEBI:36739) |
| Incoming Relation(s) |
| (6R)-vomifoliol (CHEBI:49161) is a vomifoliol (CHEBI:28258) |
| (6S)-vomifoliol (CHEBI:49156) is a vomifoliol (CHEBI:28258) |
| IUPAC Name |
|---|
| 4-hydroxy-4-[(1E)-3-hydroxybut-1-en-1-yl]-3,5,5-trimethylcyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| (+/-)-6-Hydroxy-3-oxo-alpha-ionol | KEGG COMPOUND |
| (+/-)-6-hydroxy-3-oxo-alpha-ionol | ChEBI |
| Vomifoliol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04166 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2331902 | Beilstein |
| Reaxys:2331902 | Reaxys |
| Citations |
|---|