EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO5 |
| Net Charge | 0 |
| Average Mass | 189.167 |
| Monoisotopic Mass | 189.06372 |
| SMILES | N[C@@H](CCCC(=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H11NO5/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4H,1-3,8H2,(H,10,11)(H,12,13)/t4-/m0/s1 |
| InChIKey | UKCSFKLWNHUBDY-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-amino-6-oxopimelic acid (CHEBI:28245) has functional parent pimelic acid (CHEBI:30531) |
| (S)-2-amino-6-oxopimelic acid (CHEBI:28245) is a oxo dicarboxylic acid (CHEBI:36145) |
| (S)-2-amino-6-oxopimelic acid (CHEBI:28245) is conjugate acid of (S)-2-amino-6-oxopimelate (CHEBI:58556) |
| Incoming Relation(s) |
| (S)-2-acetamido-6-oxopimelic acid (CHEBI:17355) has functional parent (S)-2-amino-6-oxopimelic acid (CHEBI:28245) |
| (S)-2-amino-6-oxopimelate (CHEBI:58556) is conjugate base of (S)-2-amino-6-oxopimelic acid (CHEBI:28245) |
| IUPAC Name |
|---|
| (2S)-2-amino-6-oxoheptanedioic acid |
| Synonyms | Source |
|---|---|
| 2-AMINO-6-OXOPIMELIC ACID | PDBeChem |
| (S)-2-amino-6-oxoheptanedioic acid | ChemIDplus |
| L-2-Amino-6-oxoheptanedioate | KEGG COMPOUND |
| L-2-Amino-6-oxopimelate | KEGG COMPOUND |
| L-α-amino-ε-keto-pimelic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:75650-93-0 | ChemIDplus |