EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28241 - papaverine
| Formula | C20H21NO4 |
| Net Charge | 0 |
| Average Mass | 339.391 |
| Monoisotopic Mass | 339.14706 |
| SMILES | COc1ccc(Cc2nccc3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C20H21NO4/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16/h5-8,10-12H,9H2,1-4H3 |
| InChIKey | XQYZDYMELSJDRZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| papaverine (CHEBI:28241) has role antispasmodic drug (CHEBI:53784) |
| papaverine (CHEBI:28241) has role vasodilator agent (CHEBI:35620) |
| papaverine (CHEBI:28241) is a benzylisoquinoline alkaloid (CHEBI:22750) |
| papaverine (CHEBI:28241) is a dimethoxybenzene (CHEBI:51681) |
| papaverine (CHEBI:28241) is a isoquinolines (CHEBI:24922) |
| IUPAC Name |
|---|
| 1-(3,4-dimethoxybenzyl)-6,7-dimethoxyisoquinoline |
| Citations |
|---|