EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21NO4 |
| Net Charge | 0 |
| Average Mass | 339.391 |
| Monoisotopic Mass | 339.14706 |
| SMILES | COc1ccc(Cc2nccc3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C20H21NO4/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16/h5-8,10-12H,9H2,1-4H3 |
| InChIKey | XQYZDYMELSJDRZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. vasodilator agent A drug used to cause dilation of the blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| papaverine (CHEBI:28241) has role antidiarrhoeal drug (CHEBI:55323) |
| papaverine (CHEBI:28241) has role antineoplastic agent (CHEBI:35610) |
| papaverine (CHEBI:28241) has role antispasmodic drug (CHEBI:53784) |
| papaverine (CHEBI:28241) has role vasodilator agent (CHEBI:35620) |
| papaverine (CHEBI:28241) is a benzylisoquinoline alkaloid (CHEBI:22750) |
| papaverine (CHEBI:28241) is a dimethoxybenzene (CHEBI:51681) |
| papaverine (CHEBI:28241) is a isoquinolines (CHEBI:24922) |
| IUPAC Name |
|---|
| 1-(3,4-dimethoxybenzyl)-6,7-dimethoxyisoquinoline |
| Synonyms | Source |
|---|---|
| NSC-136630 | ChEMBL |
| Papaverine | ChEMBL |
| Papaverinum | ChEMBL |
| Citations |
|---|