EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O2 |
| Net Charge | 0 |
| Average Mass | 200.237 |
| Monoisotopic Mass | 200.08373 |
| SMILES | O[C@@H]1C2=C(C=C[C@@H]1O)Cc1ccccc12 |
| InChI | InChI=1S/C13H12O2/c14-11-6-5-9-7-8-3-1-2-4-10(8)12(9)13(11)15/h1-6,11,13-15H,7H2/t11-,13-/m0/s1 |
| InChIKey | BEUONYFZDLXHIB-AAEUAGOBSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(3S,4R)-3,4-dihydroxy-3,4-dihydrofluorene (CHEBI:28234) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (3S,4R)-4,9-dihydro-3H-fluorene-3,4-diol |
| Synonym | Source |
|---|---|
| (+)-(3S,4R)-cis-3,4-Dihydroxy-3,4-dihydrofluorene | KEGG COMPOUND |