EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O5 |
| Net Charge | 0 |
| Average Mass | 346.423 |
| Monoisotopic Mass | 346.17802 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]23CCC[C@@]1(C)C(=O)OC3 |
| InChI | InChI=1S/C20H26O5/c1-11-8-19-9-20(11,24)7-4-12(19)18-6-3-5-17(2,16(23)25-10-18)14(18)13(19)15(21)22/h12-14,24H,1,3-10H2,2H3,(H,21,22)/t12-,13+,14+,17+,18+,19-,20-/m0/s1 |
| InChIKey | KSBJAONOPKRVRR-YTJHIPEWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A44 (CHEBI:28211) has role plant metabolite (CHEBI:76924) |
| gibberellin A44 (CHEBI:28211) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A44 (CHEBI:28211) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A44 (CHEBI:28211) is a lactone (CHEBI:25000) |
| gibberellin A44 (CHEBI:28211) is conjugate acid of gibberellin A44(1−) (CHEBI:58554) |
| Incoming Relation(s) |
| gibberellin A44(1−) (CHEBI:58554) is conjugate base of gibberellin A44 (CHEBI:28211) |
| IUPAC Names |
|---|
| (1R,2R,5S,8S,9S,10S,11R)-5-hydroxy-11-methyl-6-methylidene-12-oxo-13-oxapentacyclo[9.3.3.15,8.01,10.02,8]octadecane-9-carboxylic acid |
| (1R,4aR,4bR,7S,9aS,10S,10aS)-7-hydroxy-1-methyl-8-methylidene-12-oxododecahydro-7,9a-methano-1,4a-(methanooxymethano)benzo[a]azulene-10-carboxylic acid |
| 7α-hydroxy-1β-methyl-8-methylidene-12-oxo-1α,4a-(methanooxymethano)-4aα,4bβ-gibbane-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| GA44 | ChEBI |
| Gibberellin 44 | KEGG COMPOUND |
| Gibberellin A44 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000044 | KNApSAcK |
| C12308 | KEGG COMPOUND |
| CPD-638 | MetaCyc |
| HMDB0036901 | HMDB |
| LMPR0104170030 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6689821 | Reaxys |
| Citations |
|---|