EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O2 |
| Net Charge | 0 |
| Average Mass | 262.353 |
| Monoisotopic Mass | 262.16813 |
| SMILES | [H][C@@]12CCCCN1C[C@@H]1C[C@H]2C(=O)N2C1=CCCC2O |
| InChI | InChI=1S/C15H22N2O2/c18-14-6-3-5-12-10-8-11(15(19)17(12)14)13-4-1-2-7-16(13)9-10/h5,10-11,13-14,18H,1-4,6-9H2/t10?,11?,13-,14?/m0/s1 |
| InChIKey | JHXYFYGGFKMUPN-QHNNHONCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Argyrolobine (CHEBI:2820) is a quinolizidine alkaloid (CHEBI:26515) |
| Synonym | Source |
|---|---|
| Argyrolobine | KEGG COMPOUND |