EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H67NO12 |
| Net Charge | 0 |
| Average Mass | 717.938 |
| Monoisotopic Mass | 717.46633 |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@](C)(O)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C37H67NO12/c1-14-26-20(4)29(40)21(5)28(39)18(2)16-36(9,44)33(50-35-30(41)25(38(11)12)15-19(3)46-35)22(6)31(23(7)34(43)48-26)49-27-17-37(10,45-13)32(42)24(8)47-27/h18-27,29-33,35,40-42,44H,14-17H2,1-13H3/t18-,19-,20+,21+,22+,23-,24+,25+,26-,27+,29+,30-,31+,32+,33-,35+,36-,37-/m1/s1 |
| InChIKey | IDRYSCOQVVUBIJ-PPGFLMPOSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erythromycin B (CHEBI:28196) has functional parent erythronolide B (CHEBI:27977) |
| erythromycin B (CHEBI:28196) is a erythromycin (CHEBI:48923) |
| IUPAC Name |
|---|
| (3R,4S,5S,6R,7R,9R,11R,12S,13R,14R)-4-(2,6-dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranosyloxy)-14-ethyl-7,12-dihydroxy-6-[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyloxy]-3,5,7,9,11,13-hexamethyloxacyclotetradecane-2,10-dione |
| INNs | Source |
|---|---|
| berythromycin | ChemIDplus |
| beritromicina | ChemIDplus |
| berythromycinum | ChemIDplus |
| bérythromycine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Erythromycin B | KEGG COMPOUND |
| 12-deoxyerythromycin | ChemIDplus |
| Berythromycin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06653 | KEGG COMPOUND |
| D03098 | KEGG DRUG |
| LMPK04000012 | LIPID MAPS |
| CN101104631 | Patent |
| CPD-13805 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5206722 | Beilstein |
| Reaxys:74652 | Reaxys |
| CAS:527-75-3 | ChemIDplus |
| Citations |
|---|