EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N4O3 |
| Net Charge | 0 |
| Average Mass | 406.486 |
| Monoisotopic Mass | 406.20049 |
| SMILES | O=C(N1C[C@@H]2C[C@H](C1)c1cccc(=O)n1C2)N1C[C@@H]2C[C@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C23H26N4O3/c28-21-5-1-3-19-17-7-15(11-26(19)21)9-24(13-17)23(30)25-10-16-8-18(14-25)20-4-2-6-22(29)27(20)12-16/h1-6,15-18H,7-14H2 |
| InChIKey | AILDTIZEPVHXBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Argentine (CHEBI:2819) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| Argentine | KEGG COMPOUND |