EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12Cl2N2 |
| Net Charge | 0 |
| Average Mass | 267.159 |
| Monoisotopic Mass | 266.03775 |
| SMILES | Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C13H12Cl2N2/c14-10-6-8(1-3-12(10)16)5-9-2-4-13(17)11(15)7-9/h1-4,6-7H,5,16-17H2 |
| InChIKey | IBOFVQJTBBUKMU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4'-methylene-bis-(2-chloroaniline) (CHEBI:28124) has role metabolite (CHEBI:25212) |
| 4,4'-methylene-bis-(2-chloroaniline) (CHEBI:28124) is a chloroaniline (CHEBI:23130) |
| IUPAC Name |
|---|
| 4,4'-methanediylbis(2-chloroaniline) |
| Synonyms | Source |
|---|---|
| Methylenebis(chloroaniline) | KEGG COMPOUND |
| MOCA | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C10999 | KEGG COMPOUND |
| 4,4'-Methylenebis(2-chloroaniline) | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1882318 | Reaxys |
| CAS:101-14-4 | KEGG COMPOUND |
| CAS:101-14-4 | ChemIDplus |
| Citations |
|---|