EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O4 |
| Net Charge | 0 |
| Average Mass | 324.376 |
| Monoisotopic Mass | 324.13616 |
| SMILES | CC(C)=CCc1c(O)ccc(C(=O)/C=C/c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C20H20O4/c1-13(2)3-9-16-19(23)12-10-17(20(16)24)18(22)11-6-14-4-7-15(21)8-5-14/h3-8,10-12,21,23-24H,9H2,1-2H3/b11-6+ |
| InChIKey | DUWPGRAKHMEPCM-IZZDOVSWSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isobavachalcone (CHEBI:28106) has functional parent trans-chalcone (CHEBI:48965) |
| isobavachalcone (CHEBI:28106) has role antibacterial agent (CHEBI:33282) |
| isobavachalcone (CHEBI:28106) has role metabolite (CHEBI:25212) |
| isobavachalcone (CHEBI:28106) has role platelet aggregation inhibitor (CHEBI:50427) |
| isobavachalcone (CHEBI:28106) is a chalcones (CHEBI:23086) |
| isobavachalcone (CHEBI:28106) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2E)-1-[2,4-dihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 2',4,4'-trihydroxy-3'-(3-methyl-2-butenyl)chalcone | ChEBI |
| Isobavachalcone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002381 | KNApSAcK |
| C08648 | KEGG COMPOUND |
| LMPK12120039 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2004917 | Reaxys |
| CAS:20784-50-3 | ChemIDplus |
| CAS:20784-50-3 | KEGG COMPOUND |
| Citations |
|---|