EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O4 |
| Net Charge | 0 |
| Average Mass | 324.376 |
| Monoisotopic Mass | 324.13616 |
| SMILES | CC(C)=CCc1c(O)ccc(C(=O)/C=C/c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C20H20O4/c1-13(2)3-9-16-19(23)12-10-17(20(16)24)18(22)11-6-14-4-7-15(21)8-5-14/h3-8,10-12,21,23-24H,9H2,1-2H3/b11-6+ |
| InChIKey | DUWPGRAKHMEPCM-IZZDOVSWSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isobavachalcone (CHEBI:28106) has functional parent trans-chalcone (CHEBI:48965) |
| isobavachalcone (CHEBI:28106) has role antibacterial agent (CHEBI:33282) |
| isobavachalcone (CHEBI:28106) has role metabolite (CHEBI:25212) |
| isobavachalcone (CHEBI:28106) has role platelet aggregation inhibitor (CHEBI:50427) |
| isobavachalcone (CHEBI:28106) is a chalcones (CHEBI:23086) |
| isobavachalcone (CHEBI:28106) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2E)-1-[2,4-dihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Synonyms | Source |
|---|---|
| Isobavachalcone | KEGG COMPOUND |
| 2',4,4'-trihydroxy-3'-(3-methyl-2-butenyl)chalcone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08648 | KEGG COMPOUND |
| LMPK12120039 | LIPID MAPS |
| C00002381 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2004917 | Reaxys |
| CAS:20784-50-3 | KEGG COMPOUND |
| CAS:20784-50-3 | ChemIDplus |
| Citations |
|---|