EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | O=C1c2c(O)cc(O)cc2O[C@H](c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C15H12O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,14-17,19H/t14-,15+/m0/s1 |
| InChIKey | SUYJZKRQHBQNCA-LSDHHAIUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimutagen An agent that reduces or interferes with the mutagenic actions or effects of a substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinobanksin (CHEBI:28103) has role antimutagen (CHEBI:73190) |
| pinobanksin (CHEBI:28103) has role antioxidant (CHEBI:22586) |
| pinobanksin (CHEBI:28103) has role metabolite (CHEBI:25212) |
| pinobanksin (CHEBI:28103) is a secondary α-hydroxy ketone (CHEBI:2468) |
| pinobanksin (CHEBI:28103) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2R,3R)-3,5,7-trihydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2,3-Dihydro-3,5,7-trihydroxy-2-phenyl-4H-1-benzopyran-4-one | ChemIDplus |
| 3,5,7-Trihydroxyflavanone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000991 | KNApSAcK |
| C09826 | KEGG COMPOUND |
| CPD-6992 | MetaCyc |
| Pinobanksin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:91238 | Reaxys |
| CAS:548-82-3 | ChemIDplus |
| CAS:548-82-3 | KEGG COMPOUND |
| Citations |
|---|