EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO5 |
| Net Charge | 0 |
| Average Mass | 175.140 |
| Monoisotopic Mass | 175.04807 |
| SMILES | NC(C(=O)O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C6H9NO5/c7-5(6(11)12)3(8)1-2-4(9)10/h5H,1-2,7H2,(H,9,10)(H,11,12) |
| InChIKey | HXWZRYKURKEOSO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-3-oxoadipic acid (CHEBI:28095) has functional parent adipic acid (CHEBI:30832) |
| 2-amino-3-oxoadipic acid (CHEBI:28095) has role human metabolite (CHEBI:77746) |
| 2-amino-3-oxoadipic acid (CHEBI:28095) has role mouse metabolite (CHEBI:75771) |
| 2-amino-3-oxoadipic acid (CHEBI:28095) is a amino dicarboxylic acid (CHEBI:36164) |
| 2-amino-3-oxoadipic acid (CHEBI:28095) is a oxo dicarboxylic acid (CHEBI:36145) |
| IUPAC Name |
|---|
| 2-amino-3-oxohexanedioic acid |
| Synonyms | Source |
|---|---|
| 2-Amino-3-oxoadipate | KEGG COMPOUND |
| 2-amino-3-oxo-hexanedioic acid | LIPID MAPS |
| 2-Amino-3-oxohexanedioic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05520 | KEGG COMPOUND |
| LMFA01100036 | LIPID MAPS |