EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N2O9P |
| Net Charge | 0 |
| Average Mass | 324.182 |
| Monoisotopic Mass | 324.03587 |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2OP(=O)(O)O)c(=O)n1 |
| InChI | InChI=1S/C9H13N2O9P/c12-3-4-6(14)7(20-21(16,17)18)8(19-4)11-2-1-5(13)10-9(11)15/h1-2,4,6-8,12,14H,3H2,(H,10,13,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | HQIDPEYTETUCNF-XVFCMESISA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| uridine 2'-phosphate (CHEBI:28070) is a pyrimidine ribonucleoside 2'-monophosphate (CHEBI:37651) |
| uridine 2'-phosphate (CHEBI:28070) is a uridine phosphate (CHEBI:27237) |
| uridine 2'-phosphate (CHEBI:28070) is conjugate acid of uridine 2'-phosphate(2−) (CHEBI:77802) |
| Incoming Relation(s) |
| uridine 2'-phosphate(2−) (CHEBI:77802) is conjugate base of uridine 2'-phosphate (CHEBI:28070) |
| IUPAC Name |
|---|
| 2'-uridylic acid |
| Synonyms | Source |
|---|---|
| Uridine 2'-monophosphate | ChemIDplus |
| Uridine 2'-phosphate | KEGG COMPOUND |