EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20N2O4S |
| Net Charge | 0 |
| Average Mass | 324.402 |
| Monoisotopic Mass | 324.11438 |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C15H20N2O4S/c1-11(18)12-7-9-14(10-8-12)22(20,21)17-15(19)16-13-5-3-2-4-6-13/h7-10,13H,2-6H2,1H3,(H2,16,17,19) |
| InChIKey | VGZSUPCWNCWDAN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | insulin secretagogue A secretagogue that causes the secretion of insulin. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetohexamide (CHEBI:28052) has role hypoglycemic agent (CHEBI:35526) |
| acetohexamide (CHEBI:28052) has role insulin secretagogue (CHEBI:90415) |
| acetohexamide (CHEBI:28052) is a N-sulfonylurea (CHEBI:76983) |
| acetohexamide (CHEBI:28052) is a acetophenones (CHEBI:22187) |
| IUPAC Name |
|---|
| 4-acetyl-N-(cyclohexylcarbamoyl)benzene-1-sulfonamide |
| INNs | Source |
|---|---|
| acetohexamida | WHO MedNet |
| acetohexamide | WHO MedNet |
| acétohexamide | WHO MedNet |
| acetohexamidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-((p-Acetylphenyl)sulfonyl)-3-cyclohexylurea | ChemIDplus |
| 4-Acetyl-N-((cyclohexylamino)carbonyl)benzenesulfonamide | ChemIDplus |
| Dymelor | ChemIDplus |
| N-(p-Acetylphenylsulfonyl)-N'-cyclohexylurea | ChemIDplus |
| Brand Name | Source |
|---|---|
| Dymelor | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 57 | DrugCentral |
| Acetohexamide | Wikipedia |
| C06806 | KEGG COMPOUND |
| D00219 | KEGG DRUG |
| DB00414 | DrugBank |
| HMDB0014558 | HMDB |
| LSM-5638 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2225115 | Reaxys |
| CAS:968-81-0 | ChemIDplus |
| CAS:968-81-0 | KEGG COMPOUND |
| Citations |
|---|