EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | CC/C=C\C[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h3-4,6-7,12-13,15-17,19,21,23H,2,5,8-11,14H2,1H3,(H,24,25)/b6-3-,7-4-,13-12+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | CBOMORHDRONZRN-QLOYDKTKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin E3 (CHEBI:28031) has role human metabolite (CHEBI:77746) |
| prostaglandin E3 (CHEBI:28031) is a prostaglandins E (CHEBI:26338) |
| prostaglandin E3 (CHEBI:28031) is conjugate acid of prostaglandin E3(1−) (CHEBI:133132) |
| Incoming Relation(s) |
| prostaglandin E3(1−) (CHEBI:133132) is conjugate base of prostaglandin E3 (CHEBI:28031) |
| IUPAC Name |
|---|
| (5Z,13E,15S,17Z)-11α,15-dihydroxy-9-oxoprosta-5,13,17-trien-1-oic acid |
| Synonyms | Source |
|---|---|
| (5Z,11α,13E,15S,17Z)-11,15-dihydroxy-9-oxoprosta-5,13,17-trien-1-oic acid | ChemIDplus |
| 9-oxo-11R,15S-dihydroxy-5Z,13E,17Z-prostatrienoic acid | LIPID MAPS |
| PGE3 | ChemIDplus |
| Prostaglandin E3 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06439 | KEGG COMPOUND |
| LMFA03010135 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2899956 | Beilstein |
| CAS:802-31-3 | ChemIDplus |
| CAS:802-31-3 | KEGG COMPOUND |