EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | O=C(O)C(=O)CCCCO |
| InChI | InChI=1S/C6H10O4/c7-4-2-1-3-5(8)6(9)10/h7H,1-4H2,(H,9,10) |
| InChIKey | KIKUKXLMZJYPTL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxy-2-oxohexanoic acid (CHEBI:28028) has functional parent hexanoic acid (CHEBI:30776) |
| 6-hydroxy-2-oxohexanoic acid (CHEBI:28028) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 6-hydroxy-2-oxohexanoic acid (CHEBI:28028) is a 6-hydroxy monocarboxylic acid (CHEBI:35971) |
| IUPAC Name |
|---|
| 6-hydroxy-2-oxohexanoic acid |
| Synonyms | Source |
|---|---|
| 2-keto-6-hydroxyhexanoic acid | ChEBI |
| 6-hydroxy-2-oxo-hexanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1756645 | Beilstein |
| CAS:68469-37-4 | ChEBI |
| Citations |
|---|