EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 250.081 |
| Monoisotopic Mass | 248.99595 |
| SMILES | N[C@@H](Cc1cc(Cl)c(O)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C9H9Cl2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1 |
| InChIKey | MPHURJQUHZHALJ-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dichloro-L-tyrosine (CHEBI:28016) is a chloroamino acid (CHEBI:23129) |
| 3,5-dichloro-L-tyrosine (CHEBI:28016) is a dichlorobenzene (CHEBI:23697) |
| 3,5-dichloro-L-tyrosine (CHEBI:28016) is a dihalogenated L-tyrosine (CHEBI:53680) |
| 3,5-dichloro-L-tyrosine (CHEBI:28016) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Synonyms | Source |
|---|---|
| 3,5-Dichloro-L-tyrosine | KEGG COMPOUND |
| 3,5-dichlorotyrosine | ChEBI |
| DiClY | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C03347 | KEGG COMPOUND |
| Citations |
|---|