EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O3S |
| Net Charge | 0 |
| Average Mass | 270.354 |
| Monoisotopic Mass | 270.10381 |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H18N2O3S/c1-3-4-9-13-12(15)14-18(16,17)11-7-5-10(2)6-8-11/h5-8H,3-4,9H2,1-2H3,(H2,13,14,15) |
| InChIKey | JLRGJRBPOGGCBT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). insulin secretagogue A secretagogue that causes the secretion of insulin. potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolbutamide (CHEBI:27999) has role human metabolite (CHEBI:77746) |
| tolbutamide (CHEBI:27999) has role hypoglycemic agent (CHEBI:35526) |
| tolbutamide (CHEBI:27999) has role insulin secretagogue (CHEBI:90415) |
| tolbutamide (CHEBI:27999) has role potassium channel blocker (CHEBI:50509) |
| tolbutamide (CHEBI:27999) is a N-sulfonylurea (CHEBI:76983) |
| IUPAC Name |
|---|
| N-[(butylamino)carbonyl]-4-methylbenzenesulfonamide |
| INNs | Source |
|---|---|
| tolbutamidum | ChemIDplus |
| tolbutamide | ChemIDplus |
| tolbutamida | ChemIDplus |
| Synonyms | Source |
|---|---|
| Tolbutamide | KEGG COMPOUND |
| 1-Butyl-3-(p-methylphenylsulfonyl)urea | ChemIDplus |
| 1-Butyl-3-(p-tolylsulfonyl)urea | ChemIDplus |
| 1-Butyl-3-tosylurea | ChemIDplus |
| N-(4-Methylphenylsulfonyl)-N'-butylurea | ChemIDplus |
| N-Butyl-N'-(4-methylphenylsulfonyl)urea | ChemIDplus |
| Citations |
|---|