EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | O=C(O)[C@H]1C[C@H](O)CN1 |
| InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m0/s1 |
| InChIKey | PMMYEEVYMWASQN-IUYQGCFVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-4-hydroxy-D-proline (CHEBI:27992) is a 4-hydroxy-D-proline (CHEBI:144637) |
| IUPAC Name |
|---|
| (4S)-4-hydroxy-D-proline |
| Synonyms | Source |
|---|---|
| (2R,4S)-4-hydroxypyrrolidine-2-carboxylic acid | ChEBI |
| 4α-hydroxy-D-proline | ChEBI |
| H-D-Hyp-OH | ChEBI |
| trans-4-hydroxy-D-proline | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03651 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:3398-22-9 | ChEBI |