EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27990 - 3-ethoxybenzoic acid
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | CCOc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C9H10O3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| InChIKey | DTFQMPQJMDEWKJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-ethoxybenzoic acid (CHEBI:27990) has functional parent benzoic acid (CHEBI:30746) |
| 3-ethoxybenzoic acid (CHEBI:27990) is a ethoxybenzoic acid (CHEBI:23984) |
| 3-ethoxybenzoic acid (CHEBI:27990) is conjugate acid of 3-ethoxybenzoate (CHEBI:36648) |
| Incoming Relation(s) |
| 3-ethoxybenzoate (CHEBI:36648) is conjugate base of 3-ethoxybenzoic acid (CHEBI:27990) |
| IUPAC Name |
|---|
| 3-ethoxybenzoic acid |
| Synonyms | Source |
|---|---|
| 3-Ethoxybenzoate | KEGG COMPOUND |
| 3-Ethoxybenzoic acid | KEGG COMPOUND |