EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6N2O8 |
| Net Charge | 0 |
| Average Mass | 270.153 |
| Monoisotopic Mass | 270.01242 |
| SMILES | O=C(O)C(=O)Cc1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H6N2O8/c12-7(9(14)15)3-4-1-5(10(16)17)8(13)6(2-4)11(18)19/h1-2,13H,3H2,(H,14,15) |
| InChIKey | AIXYOVZVCBPJAR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dinitro-4-hydroxyphenylpyruvic acid (CHEBI:27981) has functional parent 2,6-dinitrophenol (CHEBI:39357) |
| 3,5-dinitro-4-hydroxyphenylpyruvic acid (CHEBI:27981) has functional parent pyruvic acid (CHEBI:32816) |
| 3,5-dinitro-4-hydroxyphenylpyruvic acid (CHEBI:27981) is a C-nitro compound (CHEBI:35716) |
| 3,5-dinitro-4-hydroxyphenylpyruvic acid (CHEBI:27981) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 3,5-dinitro-4-hydroxyphenylpyruvic acid (CHEBI:27981) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-(4-hydroxy-3,5-dinitrophenyl)-2-oxopropanoic acid |
| Synonym | Source |
|---|---|
| 3-(4-hydroxy-3,5-dinitrophenyl)-2-oxopropionic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C04286 | KEGG COMPOUND |