EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC1(C)O[C@]2(C)CC[C@H]1CC2 |
| InChI | InChI=1S/C10H18O/c1-9(2)8-4-6-10(3,11-9)7-5-8/h8H,4-7H2,1-3H3/t8-,10+ |
| InChIKey | WEEGYLXZBRQIMU-WAAGHKOSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melaleuca alternifolia (ncbitaxon:164405) | leaf (BTO:0000713) | PubMed (16418522) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,8-cineole (CHEBI:27961) has role flavouring agent (CHEBI:35617) |
| 1,8-cineole (CHEBI:27961) is a cineole (CHEBI:23243) |
| Incoming Relation(s) |
| tea tree oil (CHEBI:83629) has part 1,8-cineole (CHEBI:27961) |
| IUPAC Name |
|---|
| 1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane |
| Synonyms | Source |
|---|---|
| 1,3,3-TRIMETHYL-2-OXABICYCLO[2.2.2]OCTANE | PDBeChem |
| 1,8-Cineol | KEGG COMPOUND |
| 1,8-cineole | IUBMB |
| 1,8-Cineole | KEGG COMPOUND |
| 1,8-epoxy-p-menthane | ChemIDplus |
| 1,8-oxido-p-menthane | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 1,8-cineole | UniProt |