EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13N5O4 |
| Net Charge | 0 |
| Average Mass | 219.201 |
| Monoisotopic Mass | 219.09675 |
| SMILES | N=C(NCCC[C@H](N)C(=O)O)N[N+](=O)[O-] |
| InChI | InChI=1S/C6H13N5O4/c7-4(5(12)13)2-1-3-9-6(8)10-11(14)15/h4H,1-3,7H2,(H,12,13)(H3,8,9,10)/t4-/m0/s1 |
| InChIKey | MRAUNPAHJZDYCK-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nγ-nitro-L-arginine (CHEBI:27960) is a N-nitro compound (CHEBI:38780) |
| Nγ-nitro-L-arginine (CHEBI:27960) is a L-arginine derivative (CHEBI:83965) |
| Nγ-nitro-L-arginine (CHEBI:27960) is a guanidines (CHEBI:24436) |
| Nγ-nitro-L-arginine (CHEBI:27960) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Synonym | Source |
|---|---|
| Ngamma-Nitro-L-arginine | KEGG COMPOUND |