EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27953 - physostigmine
| Formula | C15H21N3O2 |
| Net Charge | 0 |
| Average Mass | 275.352 |
| Monoisotopic Mass | 275.16338 |
| SMILES | [H][C@]12N(C)CC[C@@]1(C)c1cc(OC(=O)NC)ccc1N2C |
| InChI | InChI=1S/C15H21N3O2/c1-15-7-8-17(3)13(15)18(4)12-6-5-10(9-11(12)15)20-14(19)16-2/h5-6,9,13H,7-8H2,1-4H3,(H,16,19)/t13-,15+/m1/s1 |
| InChIKey | PIJVFDBKTWXHHD-HIFRSBDPSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). miotic An agent causing contraction of the pupil of the eye. Because the size of the pupil is under the antagonistic control of the sympathetic and parasympathetic systems, drugs affecting either system can cause miosis. Drugs that mimic or potentiate the parasympathetic input to the circular constrictor muscle and drugs that inhibit sympathetic input to the radial dilator muscle tend to contract the pupils. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antidote to curare poisoning A role borne by a molecule that acts to counteract or neutralize the deleterious effects of curare. miotic An agent causing contraction of the pupil of the eye. Because the size of the pupil is under the antagonistic control of the sympathetic and parasympathetic systems, drugs affecting either system can cause miosis. Drugs that mimic or potentiate the parasympathetic input to the circular constrictor muscle and drugs that inhibit sympathetic input to the radial dilator muscle tend to contract the pupils. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| physostigmine (CHEBI:27953) has role antidote to curare poisoning (CHEBI:74530) |
| physostigmine (CHEBI:27953) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| physostigmine (CHEBI:27953) has role miotic (CHEBI:51068) |
| physostigmine (CHEBI:27953) is a carbamate ester (CHEBI:23003) |
| physostigmine (CHEBI:27953) is a indole alkaloid (CHEBI:38958) |
| Incoming Relation(s) |
| physostigmine salicylate (CHEBI:48883) has part physostigmine (CHEBI:27953) |
| IUPAC Name |
|---|
| (3aS,8aR)-1,3a,8-trimethyl-1,2,3,3a,8,8a-hexahydropyrrolo[2,3-b]indol-5-yl methylcarbamate |
| Synonyms | Source |
|---|---|
| Physostigmine | KEGG COMPOUND |
| Eserine | KEGG DRUG |
| Physostol | ChemIDplus |
| Antilirium | ChemIDplus |