EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O4 |
| Net Charge | 0 |
| Average Mass | 208.213 |
| Monoisotopic Mass | 208.07356 |
| SMILES | [H]C(=O)/C=C/c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C11H12O4/c1-14-9-6-8(4-3-5-12)7-10(15-2)11(9)13/h3-7,13H,1-2H3/b4-3+ |
| InChIKey | CDICDSOGTRCHMG-ONEGZZNKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-sinapaldehyde (CHEBI:27949) has functional parent (E)-cinnamaldehyde (CHEBI:16731) |
| (E)-sinapaldehyde (CHEBI:27949) has role antifungal agent (CHEBI:35718) |
| (E)-sinapaldehyde (CHEBI:27949) has role plant metabolite (CHEBI:76924) |
| (E)-sinapaldehyde (CHEBI:27949) is a cinnamaldehydes (CHEBI:23245) |
| (E)-sinapaldehyde (CHEBI:27949) is a dimethoxybenzene (CHEBI:51681) |
| (E)-sinapaldehyde (CHEBI:27949) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| (E)-nesocodin (alcohol-form) zwitterion (CHEBI:191394) has functional parent (E)-sinapaldehyde (CHEBI:27949) |
| (E)-nesocodin (oxo-form) zwitterion (CHEBI:191393) has functional parent (E)-sinapaldehyde (CHEBI:27949) |
| (E)-sinapaldehyde 4-O-β-D-glucopyranoside (CHEBI:142126) has functional parent (E)-sinapaldehyde (CHEBI:27949) |
| 4-acetoxy-3,5-dimethoxy-trans-cinnamaldehyde (CHEBI:86587) has functional parent (E)-sinapaldehyde (CHEBI:27949) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enal |
| Synonyms | Source |
|---|---|
| (2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)acrylaldehyde | ChEBI |
| (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-propenal | ChemIDplus |
| (E)-sinapoyl aldehyde | ChEBI |
| Sinapaldehyde | KEGG COMPOUND |
| Sinapoyl aldehyde | KEGG COMPOUND |
| sinapyl aldehyde | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (E)-sinapaldehyde | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00002775 | KNApSAcK |
| C05610 | KEGG COMPOUND |
| C05610 | KEGG COMPOUND |
| Sinapaldehyde | Wikipedia |
| SINAPALDEHYDE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2215799 | Reaxys |
| CAS:4206-58-0 | KEGG COMPOUND |
| CAS:4206-58-0 | ChemIDplus |
| Citations |
|---|