EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO2 |
| Net Charge | 0 |
| Average Mass | 167.208 |
| Monoisotopic Mass | 167.09463 |
| SMILES | N[C@@H](CC1=CCC=CC1)C(=O)O |
| InChI | InChI=1S/C9H13NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-2,5,8H,3-4,6,10H2,(H,11,12)/t8-/m0/s1 |
| InChIKey | FSZMHEMPLAVBQZ-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dihydrophenyl-L-alanine (CHEBI:27940) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Names |
|---|
| 3-(cyclohexa-1,4-dien-1-yl)-L-alanine |
| (2S)-2-amino-3-(cyclohexa-1,4-dien-1-yl)propanoic acid |
| Synonyms | Source |
|---|---|
| 2,5-Dihydrophenylalanine | KEGG COMPOUND |
| L-2,5-Dihydrophenylalanine | ChemIDplus |
| L-3-(2,5-Cyclohexadienyl)alanine | ChemIDplus |
| (S)-alpha-Amino-1,4-cyclohexadiene-1-propanoic acid | ChemIDplus |