EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O3 |
| Net Charge | 0 |
| Average Mass | 210.233 |
| Monoisotopic Mass | 210.10044 |
| SMILES | C=CCC1(C(C)C)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C10H14N2O3/c1-4-5-10(6(2)3)7(13)11-9(15)12-8(10)14/h4,6H,1,5H2,2-3H3,(H2,11,12,13,14,15) |
| InChIKey | UORJNBVJVRLXMQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Application: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aprobarbital (CHEBI:2791) is a barbiturates (CHEBI:22693) |
| IUPAC Name |
|---|
| 5-(propan-2-yl)-5-(prop-2-en-1-yl)pyrimidine-2,4,6(1H,3H,5H)-trione |
| Synonyms | Source |
|---|---|
| 5-(1-methylethyl)-5-(2-propenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione | NIST Chemistry WebBook |
| 5-allyl-5-isopropylbarbituric acid | NIST Chemistry WebBook |
| 5-allyl-5-isopropylpyrimidine-2,4,6(1H,3H,5H)-trione | IUPAC |
| 5-isopropyl-5-allylbarbituric acid | NIST Chemistry WebBook |
| Allypropymal | ChemIDplus |
| Alurate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 232 | DrugCentral |
| Aprobarbital | Wikipedia |
| C07826 | KEGG COMPOUND |
| D00698 | KEGG DRUG |
| DB01352 | DrugBank |
| HMDB0015441 | HMDB |
| Citations |
|---|