EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O3 |
| Net Charge | 0 |
| Average Mass | 132.159 |
| Monoisotopic Mass | 132.07864 |
| SMILES | CC1OC(C)OC(C)O1 |
| InChI | InChI=1S/C6H12O3/c1-4-7-5(2)9-6(3)8-4/h4-6H,1-3H3 |
| InChIKey | SQYNKIJPMDEDEG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paraldehyde (CHEBI:27909) has role sedative (CHEBI:35717) |
| paraldehyde (CHEBI:27909) is a trioxane (CHEBI:38044) |
| IUPAC Name |
|---|
| 2,4,6-trimethyl-1,3,5-trioxane |
| Synonyms | Source |
|---|---|
| 1,3,5-trimethyl-2,4,6-trioxane | ChemIDplus |
| 2,4,6-trimethyl-s-trioxane | ChemIDplus |
| acetaldehyde trimer | NIST Chemistry WebBook |
| FEMA NO. 4010 | ChEMBL |
| NSC-9799 | ChEMBL |
| paraacetaldehyde | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 2058 | DrugCentral |
| C07834 | KEGG COMPOUND |
| C07834 | KEGG COMPOUND |
| D00705 | KEGG DRUG |
| HMDB0032456 | HMDB |
| Paraldehyde | Wikipedia |
| Citations |
|---|