EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5Cl3O3 |
| Net Charge | 0 |
| Average Mass | 255.484 |
| Monoisotopic Mass | 253.93043 |
| SMILES | O=C(O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H5Cl3O3/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13/h1-2H,3H2,(H,12,13) |
| InChIKey | SMYMJHWAQXWPDB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | defoliant A herbicide which when sprayed or dusted on plants causes its leaves to fall off. phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2,4,5-trichlorophenoxy)acetic acid (CHEBI:27903) has role defoliant (CHEBI:23582) |
| (2,4,5-trichlorophenoxy)acetic acid (CHEBI:27903) has role phenoxy herbicide (CHEBI:60575) |
| (2,4,5-trichlorophenoxy)acetic acid (CHEBI:27903) has role synthetic auxin (CHEBI:26841) |
| (2,4,5-trichlorophenoxy)acetic acid (CHEBI:27903) is a chlorophenoxyacetic acid (CHEBI:23152) |
| (2,4,5-trichlorophenoxy)acetic acid (CHEBI:27903) is a trichlorobenzene (CHEBI:27096) |
| (2,4,5-trichlorophenoxy)acetic acid (CHEBI:27903) is conjugate acid of (2,4,5-trichlorophenoxy)acetate (CHEBI:19331) |
| Incoming Relation(s) |
| (2,4,5-trichlorophenoxy)acetate (CHEBI:19331) is conjugate base of (2,4,5-trichlorophenoxy)acetic acid (CHEBI:27903) |
| IUPAC Name |
|---|
| (2,4,5-trichlorophenoxy)acetic acid |
| Synonyms | Source |
|---|---|
| 2,4,5-T | ChemIDplus |
| 2,4,5-T | KEGG COMPOUND |
| 2,4,5-Trichlorophenoxyacetic acid | KEGG COMPOUND |
| (2,4,5-Trichlorphenoxy)essigsäure | ChEBI |
| 2,4,5-Trichlorphenoxyessigsäure | ChEBI |
| Esteron 245 | NIST Chemistry WebBook |
| Citations |
|---|