EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H41N5O11 |
| Net Charge | 0 |
| Average Mass | 539.583 |
| Monoisotopic Mass | 539.28026 |
| SMILES | [H][C@]12C[C@@H](N)[C@@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](N)C[C@@H]3N)O[C@]1([H])[C@H](O)[C@H](NC)[C@@H](O[C@H]1O[C@H](CO)[C@@H](N)[C@H](O)[C@H]1O)O2 |
| InChI | InChI=1S/C21H41N5O11/c1-26-11-14(30)18-8(33-20(11)37-21-16(32)13(29)10(25)9(4-27)34-21)3-7(24)19(36-18)35-17-6(23)2-5(22)12(28)15(17)31/h5-21,26-32H,2-4,22-25H2,1H3/t5-,6+,7-,8+,9-,10-,11+,12+,13+,14-,15-,16-,17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | XZNUGFQTQHRASN-XQENGBIVSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apramycin (CHEBI:2790) has role antibacterial drug (CHEBI:36047) |
| apramycin (CHEBI:2790) has role antimicrobial agent (CHEBI:33281) |
| apramycin (CHEBI:2790) is a 2-deoxystreptamine derivative (CHEBI:61800) |
| apramycin (CHEBI:2790) is a aminoglycoside (CHEBI:47779) |
| apramycin (CHEBI:2790) is a organic heterobicyclic compound (CHEBI:27171) |
| IUPAC Name |
|---|
| (2R,3S,4R,4aR,6S,7R,8aS)-7-amino-6-{[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxy}-4-hydroxy-3-(methylamino)octahydropyrano[3,2-b]pyran-2-yl 4-amino-4-deoxy-α-D-glucopyranoside |
| INNs | Source |
|---|---|
| apramicina | ChemIDplus |
| apramycin | ChemIDplus |
| apramycine | ChemIDplus |
| apramycinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-O-(3α-amino-6α-((4-amino-4-deoxy-α-D-glucopyranosyl)oxy)-2,3,4,5aβ,6,7,8,8aα-octahydro-8β-hydroxy-7β-(methylamino)pyrano(3,2-b)pyran-2α-yl)-2-deoxy-D-streptamine | ChemIDplus |
| 4-O-((8R)-2-amino-8-O-(4-amino-4-deoxy-α-D-glucopyranosyl)-2,3,7-trideoxy-7-(methylamino)-D-glycero-α-D-allo-octodialdo-1,5:8,4-dipyranos-1-yl)-2-deoxy-D-streptamine | ChemIDplus |
| Apramycin | KEGG COMPOUND |
| APRAMYCIN | PDBeChem |
| nebramycin factor 2 | ChemIDplus |
| nebramycin II | ChemIDplus |
| Citations |
|---|