EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H6Cl2N2Pt |
| Net Charge | 0 |
| Average Mass | 300.046 |
| Monoisotopic Mass | 298.95559 |
| SMILES | [H][N]([H])([H])[Pt]([Cl])([Cl])[N]([H])([H])[H] |
| InChI | InChI=1S/2ClH.2H3N.Pt/h2*1H;2*1H3;/q;;;;+2/p-2 |
| InChIKey | LXZZYRPGZAFOLE-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. |
| Applications: | cross-linking reagent A reagent with two reactive groups, usually at opposite ends of the molecule, that are capable of reacting with and thereby forming bridges between macromolecules, principally side chains of amino acids in proteins, allowing the locations of naturally reactive areas within the proteins to be identified. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cisplatin (CHEBI:27899) has role antineoplastic agent (CHEBI:35610) |
| cisplatin (CHEBI:27899) has role apoptosis inducer (CHEBI:68495) |
| cisplatin (CHEBI:27899) has role cross-linking reagent (CHEBI:50684) |
| cisplatin (CHEBI:27899) has role ferroptosis inducer (CHEBI:173085) |
| cisplatin (CHEBI:27899) has role genotoxin (CHEBI:50902) |
| cisplatin (CHEBI:27899) has role mutagen (CHEBI:25435) |
| cisplatin (CHEBI:27899) has role nephrotoxic agent (CHEBI:50909) |
| cisplatin (CHEBI:27899) has role photosensitizing agent (CHEBI:47868) |
| cisplatin (CHEBI:27899) is a diamminedichloroplatinum (CHEBI:51214) |
| IUPAC Names |
|---|
| (SP-4-2)-diamminedichloridoplatinum |
| (SP-4-2)-diamminedichloroplatinum |
| cis-diamminedichloridoplatinum(II) |
| cis-diamminedichloroplatinum(II) |
| INNs | Source |
|---|---|
| cisplatin | ChemIDplus |
| cisplatine | ChemIDplus |
| cisplatino | ChemIDplus |
| cisplatinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| CDDP | KEGG COMPOUND |
| cis-Diamminedichloroplatinum(II) | KEGG COMPOUND |
| Cisplatin | KEGG COMPOUND |
| cis-DDP | ChemIDplus |
| cis-diamminedichloroplatinum | ChemIDplus |
| cis-diammineplatinum(II) dichloride | ChemIDplus |
| Brand Names | Source |
|---|---|
| Briplatin | ChemIDplus |
| Cismaplat | DrugBank |
| Lederplatin | DrugBank |
| Neoplatin | DrugBank |
| Platinex | DrugBank |
| Platinol | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11324567 | Reaxys |
| Gmelin:2519 | Gmelin |
| CAS:15663-27-1 | ChemIDplus |
| CAS:15663-27-1 | KEGG COMPOUND |
| Citations |
|---|