EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H6Cl2N2Pt |
| Net Charge | 0 |
| Average Mass | 300.046 |
| Monoisotopic Mass | 298.95559 |
| SMILES | [H][N]([H])([H])[Pt]([Cl])([Cl])[N]([H])([H])[H] |
| InChI | InChI=1S/2ClH.2H3N.Pt/h2*1H;2*1H3;/q;;;;+2/p-2 |
| InChIKey | LXZZYRPGZAFOLE-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. renoprotective agent Any compound that is able to prevent damage to the kidneys. anti-inflammatory agent Any compound that has anti-inflammatory effects. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antifibrotic agent Any agent which acts to reduce fibrosis. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. cross-linking reagent A reagent with two reactive groups, usually at opposite ends of the molecule, that are capable of reacting with and thereby forming bridges between macromolecules, principally side chains of amino acids in proteins, allowing the locations of naturally reactive areas within the proteins to be identified. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cisplatin (CHEBI:27899) has role anti-anaemic agent (CHEBI:75835) |
| cisplatin (CHEBI:27899) has role anti-inflammatory agent (CHEBI:67079) |
| cisplatin (CHEBI:27899) has role antiemetic (CHEBI:50919) |
| cisplatin (CHEBI:27899) has role antifibrotic agent (CHEBI:233423) |
| cisplatin (CHEBI:27899) has role antimalarial (CHEBI:38068) |
| cisplatin (CHEBI:27899) has role antineoplastic agent (CHEBI:35610) |
| cisplatin (CHEBI:27899) has role apoptosis inducer (CHEBI:68495) |
| cisplatin (CHEBI:27899) has role cross-linking reagent (CHEBI:50684) |
| cisplatin (CHEBI:27899) has role ferroptosis inducer (CHEBI:173085) |
| cisplatin (CHEBI:27899) has role genotoxin (CHEBI:50902) |
| cisplatin (CHEBI:27899) has role mutagen (CHEBI:25435) |
| cisplatin (CHEBI:27899) has role nephrotoxic agent (CHEBI:50909) |
| cisplatin (CHEBI:27899) has role photosensitizing agent (CHEBI:47868) |
| cisplatin (CHEBI:27899) has role renoprotective agent (CHEBI:231911) |
| cisplatin (CHEBI:27899) is a diamminedichloroplatinum (CHEBI:51214) |
| IUPAC Names |
|---|
| (SP-4-2)-diamminedichloridoplatinum |
| (SP-4-2)-diamminedichloroplatinum |
| cis-diamminedichloridoplatinum(II) |
| cis-diamminedichloroplatinum(II) |
| INNs | Source |
|---|---|
| cisplatin | ChemIDplus |
| cisplatine | ChemIDplus |
| cisplatino | ChemIDplus |
| cisplatinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| CDDP | KEGG COMPOUND |
| cis-Diamminedichloroplatinum(II) | KEGG COMPOUND |
| Cis-diamminedichloroplatinum ii | ChEMBL |
| Cisplatin | KEGG COMPOUND |
| CISPLATIN COMPONENT OF INT-230-6 | ChEMBL |
| CISPLATIN COMPONENT OF INT230-6 | ChEMBL |
| Brand Names | Source |
|---|---|
| Briplatin | ChemIDplus |
| Cismaplat | DrugBank |
| Lederplatin | DrugBank |
| Neoplatin | DrugBank |
| Platinex | DrugBank |
| Platinol | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11324567 | Reaxys |
| Gmelin:2519 | Gmelin |
| CAS:15663-27-1 | KEGG COMPOUND |
| CAS:15663-27-1 | ChemIDplus |
| Citations |
|---|