EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O2 |
| Net Charge | 0 |
| Average Mass | 336.435 |
| Monoisotopic Mass | 336.18378 |
| SMILES | [H][C@@]12c3c4c5ccccc5n3C(C(=O)OC)=C[C@]1(CC)CCCN2CC4 |
| InChI | InChI=1S/C21H24N2O2/c1-3-21-10-6-11-22-12-9-15-14-7-4-5-8-16(14)23(18(15)19(21)22)17(13-21)20(24)25-2/h4-5,7-8,13,19H,3,6,9-12H2,1-2H3/t19-,21+/m1/s1 |
| InChIKey | OZDNDGXASTWERN-CTNGQTDRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apovincamine (CHEBI:2787) is a alkaloid (CHEBI:22315) |
| Apovincamine (CHEBI:2787) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| apovincamina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Apovincamine | KEGG COMPOUND |
| Cis-apovincamine | ChEMBL |
| Vinpocetine related compound b | ChEMBL |
| Citations |
|---|