EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O |
| Net Charge | 0 |
| Average Mass | 412.702 |
| Monoisotopic Mass | 412.37052 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC/C(=C\C)C(C)C |
| InChI | InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h7,10,19-20,23-27,30H,8-9,11-18H2,1-6H3/b21-7+/t20-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | OSELKOCHBMDKEJ-JUGJNGJRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pelvetia siliquosa (ncbitaxon:93837) | - | PubMed (14560919) | |
| Spatoglossum variabile (WORMS:145390) | - | DOI (10.1016/S0031-9422(99)00213-7) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fucosterol (CHEBI:27865) has parent hydride stigmastane (CHEBI:26773) |
| fucosterol (CHEBI:27865) has role antioxidant (CHEBI:22586) |
| fucosterol (CHEBI:27865) has role hepatoprotective agent (CHEBI:62868) |
| fucosterol (CHEBI:27865) has role metabolite (CHEBI:25212) |
| fucosterol (CHEBI:27865) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| fucosterol (CHEBI:27865) is a 3β-sterol (CHEBI:35348) |
| fucosterol (CHEBI:27865) is a C29-steroid (CHEBI:188923) |
| fucosterol (CHEBI:27865) is a phytosterols (CHEBI:26125) |
| Incoming Relation(s) |
| (3β,24R,24'R)-fucosterol epoxide (CHEBI:15577) has functional parent fucosterol (CHEBI:27865) |
| IUPAC Name |
|---|
| (24E)-stigmasta-5,24(28)-dien-3β-ol |
| Synonyms | Source |
|---|---|
| (24E)-24-n-propylidenecholesterol | ChemIDplus |
| 24E-ethylidene-cholest-5-en-3β-ol | LIPID MAPS |
| (3beta,24E)-stigmasta-5,24(28)-dien-ol | ChEBI |
| (3β,24E)-stigmasta-5,24(28)-dien-3-ol | NIST Chemistry WebBook |
| fucosterin | NIST Chemistry WebBook |
| Fucosterol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003653 | KNApSAcK |
| C08817 | KEGG COMPOUND |
| LMST01040146 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:17605-67-3 | NIST Chemistry WebBook |
| CAS:17605-67-3 | KEGG COMPOUND |
| CAS:17605-67-3 | ChemIDplus |
| Citations |
|---|