EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 207.016 |
| Monoisotopic Mass | 205.96498 |
| SMILES | Nc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C6H4Cl2N2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
| InChIKey | BIXZHMJUSMUDOQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dichloro-4-nitroaniline (CHEBI:27864) has role antifungal agrochemical (CHEBI:86328) |
| 2,6-dichloro-4-nitroaniline (CHEBI:27864) is a aromatic fungicide (CHEBI:87034) |
| 2,6-dichloro-4-nitroaniline (CHEBI:27864) is a dichlorobenzene (CHEBI:23697) |
| 2,6-dichloro-4-nitroaniline (CHEBI:27864) is a nitroaniline (CHEBI:25550) |
| IUPAC Name |
|---|
| 2,6-dichloro-4-nitroaniline |
| Synonyms | Source |
|---|---|
| 1-amino-2,6-dichloro-4-nitrobenzene | NIST Chemistry WebBook |
| 2,6-dichloro-4-nitrobenzenamine | ChemIDplus |
| 4-nitro-2,6-dichloroaniline | ChemIDplus |
| CNA | NIST Chemistry WebBook |
| DCNA | KEGG COMPOUND |
| Dichloran | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Allisan | ChemIDplus |
| Batran | ChemIDplus |
| Bortran | ChemIDplus |
| Botran | ChemIDplus |
| Ditranil | ChemIDplus |
| Resisan | NIST Chemistry WebBook |
| Citations |
|---|