EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO4 |
| Net Charge | 0 |
| Average Mass | 189.211 |
| Monoisotopic Mass | 189.10011 |
| SMILES | [H][C@]12[C@@H](O)CCN1C[C@H](O)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C8H15NO4/c10-4-1-2-9-3-5(11)7(12)8(13)6(4)9/h4-8,10-13H,1-3H2/t4-,5-,6+,7+,8+/m0/s1 |
| InChIKey | JDVVGAQPNNXQDW-TVNFTVLESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Castanospermum australe (ncbitaxon:24962) | - | DOI (10.1016/0031-9422(81)85181-3) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. EC 3.2.1.* (glycosidase) inhibitor An EC 3.2.* (glycosylase) inhibitor that interferes with the action of any glycosidase (i.e. enzymes hydrolysing O- and S-glycosyl compounds, EC 3.2.1.*). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| castanospermine (CHEBI:27860) has role anti-HIV-1 agent (CHEBI:64947) |
| castanospermine (CHEBI:27860) has role anti-inflammatory agent (CHEBI:67079) |
| castanospermine (CHEBI:27860) has role EC 3.2.1.* (glycosidase) inhibitor (CHEBI:52424) |
| castanospermine (CHEBI:27860) has role metabolite (CHEBI:25212) |
| castanospermine (CHEBI:27860) is a indolizidine alkaloid (CHEBI:38511) |
| IUPAC Name |
|---|
| (1S,6S,7R,8R,8aR)-octahydroindolizine-1,6,7,8-tetrol |
| Synonyms | Source |
|---|---|
| Castanospermine | KEGG COMPOUND |
| CASTANOSPERMINE | PDBeChem |
| castinospermine | ChEBI |
| (1S-(1α,6β,7α,8β,8αβ))-octahydro-1,6,7,8-indolizinetetrol | ChEBI |
| (1S,6S,7R,8R,8aR)-1,6,7,8-tetrahydroxyindolizidine | ChEBI |
| 1,6,7,8-tetrahydroxyoctahydroindolizine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02256 | KEGG COMPOUND |
| CTS | PDBeChem |
| MX2009004170 | Patent |
| KR20070061879 | Patent |
| US5837709 | Patent |
| Castanospermine | Wikipedia |
| C00002028 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3588654 | Reaxys |
| CAS:79831-76-8 | KEGG COMPOUND |
| CAS:79831-76-8 | ChemIDplus |
| Citations |
|---|