EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO4 |
| Net Charge | 0 |
| Average Mass | 189.211 |
| Monoisotopic Mass | 189.10011 |
| SMILES | [H][C@]12[C@@H](O)CCN1C[C@H](O)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C8H15NO4/c10-4-1-2-9-3-5(11)7(12)8(13)6(4)9/h4-8,10-13H,1-3H2/t4-,5-,6+,7+,8+/m0/s1 |
| InChIKey | JDVVGAQPNNXQDW-TVNFTVLESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Castanospermum australe (ncbitaxon:24962) | - | DOI (10.1016/0031-9422(81)85181-3) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.* (glycosidase) inhibitor An EC 3.2.* (glycosylase) inhibitor that interferes with the action of any glycosidase (i.e. enzymes hydrolysing O- and S-glycosyl compounds, EC 3.2.1.*). anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| castanospermine (CHEBI:27860) has role anti-HIV-1 agent (CHEBI:64947) |
| castanospermine (CHEBI:27860) has role anti-inflammatory agent (CHEBI:67079) |
| castanospermine (CHEBI:27860) has role EC 3.2.1.* (glycosidase) inhibitor (CHEBI:52424) |
| castanospermine (CHEBI:27860) has role metabolite (CHEBI:25212) |
| castanospermine (CHEBI:27860) is a indolizidine alkaloid (CHEBI:38511) |
| IUPAC Name |
|---|
| (1S,6S,7R,8R,8aR)-octahydroindolizine-1,6,7,8-tetrol |
| Synonyms | Source |
|---|---|
| 1,6,7,8-tetrahydroxyoctahydroindolizine | ChEBI |
| (1S-(1α,6β,7α,8β,8αβ))-octahydro-1,6,7,8-indolizinetetrol | ChEBI |
| (1S,6S,7R,8R,8aR)-1,6,7,8-tetrahydroxyindolizidine | ChEBI |
| Castanospermine | KEGG COMPOUND |
| CASTANOSPERMINE | PDBeChem |
| castinospermine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00002028 | KNApSAcK |
| C02256 | KEGG COMPOUND |
| Castanospermine | Wikipedia |
| CTS | PDBeChem |
| KR20070061879 | Patent |
| MX2009004170 | Patent |
| US5837709 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3588654 | Reaxys |
| CAS:79831-76-8 | KEGG COMPOUND |
| CAS:79831-76-8 | ChemIDplus |
| Citations |
|---|