EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H56N4O16 |
| Net Charge | 0 |
| Average Mass | 896.944 |
| Monoisotopic Mass | 896.36913 |
| SMILES | [H][C@]12N=C(/C=C3\N[C@@](C)(CC4=C(CCC(=O)O)[C@](C)(CC(=O)O)C(=N4)/C=C4\N[C@]1(C)[C@@](C)(CC(=O)O)[C@@H]4CCC(=O)O)C(CC(=O)O)=C3CCC(=O)O)[C@](C)(CCC(=O)O)[C@H]2CC(=O)O |
| InChI | InChI=1S/C44H56N4O16/c1-40(13-12-34(55)56)25(15-36(59)60)39-44(5)42(3,20-38(63)64)23(8-11-33(53)54)27(48-44)17-30-41(2,19-37(61)62)22(7-10-32(51)52)28(45-30)18-43(4)24(14-35(57)58)21(6-9-31(49)50)26(47-43)16-29(40)46-39/h16-17,23,25,39,47-48H,6-15,18-20H2,1-5H3,(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60)(H,61,62)(H,63,64)/b26-16-,27-17-/t23-,25+,39-,40-,41+,42+,43+,44+/m1/s1 |
| InChIKey | NWRSYSRVTYBWJV-WFECKALKSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| precorrin-6Y (CHEBI:27858) is a precorrin (CHEBI:26228) |
| precorrin-6Y (CHEBI:27858) is conjugate acid of precorrin-6Y(6−) (CHEBI:58532) |
| Incoming Relation(s) |
| precorrin-6Y(6−) (CHEBI:58532) is conjugate base of precorrin-6Y (CHEBI:27858) |
| IUPAC Name |
|---|
| 3,3',3'',3'''-[(1R,2S,3S,7S,11S,17R,18R,19R)-2,7,12,18-tetrakis(carboxymethyl)-1,2,7,11,17-pentamethylcorrin-3,8,13,17-tetrayl]tetrapropanoic acid |
| Synonyms | Source |
|---|---|
| Precorrin 6Y | KEGG COMPOUND |
| Precorrin 6B | KEGG COMPOUND |
| 3-[(1R,2S,3S,7S,11S,17R,18R,19R)-2,7,12,18-tetrakis(carboxymethyl)-1,2,7,11,17-octamethylcorrin-3,8,13,17-tetrayl]tetrapropanoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C06319 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4901795 | Beilstein |
| CAS:139663-55-1 | ChemIDplus |