EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19NO3 |
| Net Charge | 0 |
| Average Mass | 285.343 |
| Monoisotopic Mass | 285.13649 |
| SMILES | C=C(C(=O)O[C@@H]1CC2[C@H]3O[C@H]3C(C1)N2C)c1ccccc1 |
| InChI | InChI=1S/C17H19NO3/c1-10(11-6-4-3-5-7-11)17(19)20-12-8-13-15-16(21-15)14(9-12)18(13)2/h3-7,12-16H,1,8-9H2,2H3/t12-,13?,14?,15-,16+ |
| InChIKey | JJNVDCBKBUSUII-UJIFDXPISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apohyoscine (CHEBI:2785) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| 1alphaH,5alphaH-Tropan-3alpha-ol, 6beta,7beta-epoxy-, atropate (ester) | KEGG COMPOUND |
| Apohyoscine | KEGG COMPOUND |