EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10INO3 |
| Net Charge | 0 |
| Average Mass | 307.087 |
| Monoisotopic Mass | 306.97054 |
| SMILES | N[C@@H](Cc1ccc(O)c(I)c1)C(=O)O |
| InChI | InChI=1S/C9H10INO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | UQTZMGFTRHFAAM-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor An EC 1.14.16.* (oxidoreductase acting on paired donors, reduced pteridine as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosine 3-monooxygenase (EC 1.14.16.2). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-iodo-L-tyrosine (CHEBI:27847) has role EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor (CHEBI:63932) |
| 3-iodo-L-tyrosine (CHEBI:27847) has role human metabolite (CHEBI:77746) |
| 3-iodo-L-tyrosine (CHEBI:27847) has role mouse metabolite (CHEBI:75771) |
| 3-iodo-L-tyrosine (CHEBI:27847) is a L-tyrosine derivative (CHEBI:27177) |
| 3-iodo-L-tyrosine (CHEBI:27847) is a monoiodotyrosine (CHEBI:25400) |
| 3-iodo-L-tyrosine (CHEBI:27847) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3-iodo-L-tyrosine (CHEBI:27847) is tautomer of 3-iodo-L-tyrosine zwitterion (CHEBI:59898) |
| Incoming Relation(s) |
| 3-iodo-L-tyrosine residue (CHEBI:90870) is substituent group from 3-iodo-L-tyrosine (CHEBI:27847) |
| 3-iodo-L-tyrosine zwitterion (CHEBI:59898) is tautomer of 3-iodo-L-tyrosine (CHEBI:27847) |
| IUPAC Name |
|---|
| 3-iodo-L-tyrosine |
| Synonyms | Source |
|---|---|
| 3-Iodo-L-tyrosine | KEGG COMPOUND |
| 3-IODO-TYROSINE | PDBeChem |
| (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid | IUPAC |
| MIT | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C02515 | KEGG COMPOUND |
| C02515 | KEGG COMPOUND |
| IYR | PDBeChem |
| DB01758 | DrugBank |
| CPD-12288 | MetaCyc |
| 3-Iodotyrosine | Wikipedia |
| HMDB0000021 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2110934 | Gmelin |
| Reaxys:2941266 | Reaxys |
| CAS:70-78-0 | KEGG COMPOUND |
| CAS:70-78-0 | ChemIDplus |
| Citations |
|---|