EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10Cl4 |
| Net Charge | 0 |
| Average Mass | 320.046 |
| Monoisotopic Mass | 317.95366 |
| SMILES | Clc1ccc(C(c2ccc(Cl)cc2)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
| InChIKey | AHJKRLASYNVKDZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DDD (CHEBI:27841) has role xenobiotic metabolite (CHEBI:76206) |
| DDD (CHEBI:27841) is a chlorophenylethane (CHEBI:23154) |
| DDD (CHEBI:27841) is a monochlorobenzenes (CHEBI:83403) |
| DDD (CHEBI:27841) is a organochlorine insecticide (CHEBI:25705) |
| IUPAC Name |
|---|
| 1,1'-(2,2-dichloroethane-1,1-diyl)bis(4-chlorobenzene) |
| Synonyms | Source |
|---|---|
| 1,1'-(2,2-dichloroethylidene)bis[4-chlorobenzene] | UM-BBD |
| 1,1-Dichloro-2,2-bis(4'-chlorophenyl)ethane | KEGG COMPOUND |
| 1,1-Dichloro-2,2-bis(4'-chlorophenyl)ethane | KEGG COMPOUND |
| 1,1-dichloro-2,2-bis(p-chlorophenyl)ethane | NIST Chemistry WebBook |
| DDD | KEGG COMPOUND |
| Dichlorodiphenyldichloroethane | KEGG COMPOUND |
| Citations |
|---|